Chelist Moleculee
JRC CODE:JRC-000376
cas:94-26-8
einecs:202-318-7
smiles:CCCCOC(=O)c1ccc(O)cc1
name:Butyl 4-Hydroxybenzoate
MW:194.2271
formula:C11H14O3
InChi:
InChiKey:
SMARTS:
Other names
Benzoic acid, 4-hydroxy-, butyl ester
Benzoic acid, p-hydroxy-, butyl ester (6CI,8CI)
4-(Butoxycarbonyl)phenol
4-Hydroxybenzoic acid butyl ester
Aseptoform Butyl
Butoben
Butyl 4-hydroxybenzoate
Butyl Butex
Butyl Tegosept
Butyl chemosept
Butyl p-hydroxybenzoate
Butyl parabens
Butyl parasept
Butylparaben
Mekkings B
NSC 13164
NSC 8475
Nipabutyl
Preserval B
SPF
Solbrol B
Tegosept B
Tegosept Butyl
n-Butyl 4-hydroxybenzoate
n-Butyl p-hydroxybenzoate
n-Butylparaben
p-Hydroxybenzoic acid butyl ester

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

TOX21 LIST1 (8205): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)
DGENV EAS (585): DG ENV EDS Database (EU Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)
NTP CYTOTOX (1353): Compound Cytotoxicity Profiling Using Quantitative High-Throughput Screening (International Research Projects)
FP6 ReProTect (133): Test chemicals used for the development of in vitro tests within the FP6 project .ReProTect (EU Research Projects)
EDC SIN List 2.0 (22): Substitute It Now List 2.0 (NGO)