|
cas: | 82640-04-8 |
---|---|
einecs: | |
smiles: | c1(c(c2ccc(O)cc2)sc2c1ccc(c2)O)C(c1ccc(OCCN2CCCCC2)cc1)=O.Cl |
name: | Raloxifene hydrochloride |
MW: | 510.044 |
formula: | C28H28ClNO4S |
InChi: | |
InChiKey: | |
SMARTS: |
Raloxifene Hydrochloride
Inventory List where this chemical is present
TOX21 LIST1 (8198): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)NICEATM ED (78): Reference chemicals used in NICEATM BG1Luc Estrogen Receptor Transactivation Assay validation study (Method Validation)
FP6 ReProTect (133): Test chemicals used for the development of in vitro tests within the FP6 project .ReProTect (EU Research Projects)