Chelist Moleculee
JRC CODE:JRC-000198
cas:76-43-7
einecs:200-961-8
smiles:[H][C@@]12CC[C@](C)(O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)CC[C@]12C
name:Fluoxymestrone
MW:336.4409
formula:C20H29FO3
InChi:
InChiKey:
SMARTS:
Other names
Ora Testryl
Oralsterone
Oratestin
Testoral
U 6040
Ultandren
Ultandrene
9α-Fluoro-11β,17β-dihydroxy-17α-methylandrost-4-ene-3-one
9α-Fluoro-11β-hydroxy-17-methyltestosterone
9α-Fluoro-11β-hydroxy-17α-methyltestosterone
Androfluorene
Androfluorone
Androsterolo
Fluotestin
Fluoximesterone
Fluoxymesterone
Flusteron
Flutestos
Halotestin
NSC 10704
NSC-12165
Neo-Ormonal
Androst-4-en-3-one, 9-fluoro-11,17-dihydroxy-17-methyl-, (11β,17β)-
Androst-4-en-3-one, 9-fluoro-11β,17β-dihydroxy-17-methyl- (6CI,8CI)
11β,17β-Dihydroxy-9α-fluoro-17α-methyl-4-androsten-3-one
17α-Methyl-9α-fluoro-11β-hydroxytestosterone
9-Fluoro-11β,17β-dihydroxy-17-methylandrost-4-en-3-one
9α-Fluoro-11β,17β-dihydroxy-17-methyl-4-androsten-3-one
9α-Fluoro-11β,17β-dihydroxy-17α-methyl-4-androsten-3-one

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

NTP CYTOTOX (1353): Compound Cytotoxicity Profiling Using Quantitative High-Throughput Screening (International Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)
NICEATM ED (78): Reference chemicals used in NICEATM BG1Luc Estrogen Receptor Transactivation Assay validation study (Method Validation)
TOX21 LIST1 (8205): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)