Chelist Moleculee
JRC CODE:JRC-000207
cas:71-58-9
einecs:200-757-9
smiles:[H][C@@]12CC[C@](OC(C)=O)(C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C[C@H](C)C2=CC(=O)CC[C@]12C
name:Medroxyprogesterone Acetate
MW:386.5244
formula:C24H34O4
InChi:
InChiKey:
SMARTS:
Other names
Pregn-4-ene-3,20-dione, 17-(acetyloxy)-6-methyl-, (6α)-
Pregn-4-ene-3,20-dione, 17-hydroxy-6α-methyl-, acetate (7CI,8CI)
Progesterone, 17-hydroxy-6α-methyl-, acetate (6CI)
17α-Acetoxy-6α-methylpregn-4-ene-3,20-dione
17α-Acetoxy-6α-methylprogesterone
17α-Hydroxy-6α-methyl-4-pregnene-3,20-dione 17-acetate
17α-Hydroxy-6α-methylpregn-4-ene-3,20-dione acetate
17α-Hydroxy-6α-methylprogesterone acetate
6α-Methyl-17-acetoxyprogesterone
6α-Methyl-17R-hydroxyprogesterone acetate
6α-Methyl-17α-Hydroxy-4-pregnene-3,20-dione acetate
6α-Methyl-17α-acetoxy-Δ4-pregnene-3,20-dione
6α-Methyl-17α-acetoxypregn-4-ene-3,20-dione
6α-Methyl-17α-hydroxyprogesterone acetate
Amen
Aragest
Aragest 5
Asconale
CBP 1011
Clinofem
Clinovir
Colirest
Curretab
Cycrin
DMPA
Depo-Clinovir
Depo-Prodasone
Depo-Provera
Depo-Ralovera
Depo-progestin
Depo-promone
Depomedroxyprogesterone acetate
Depot-medroxyprogesterone acetate
Farlutal
Farlutin
G-Farlutal
Gestapuran
Hematrol
Hysron
Indivina
Lutopolar
Lutoral
MAP
MAP (steroid)
MPA
MPA Gyn 5
Med-Pro
Medroprogesterone acetate
Medroxyprogesterone 17-acetate
Medroxyprogesterone acetate
Meprate
Metigestrona
NSC 21171
NSC 26386
Nadigest
Nidaxin
Novo-Medrone
Oragest
Perlutex
Perlutex Leo
Prodasone
Progespon
Progestalfa
Progeston
Progevera
Provera
Proverone
Ralovera
Repromap
Repromix
Sirprogen
Sodelut G
U 8839
Veramix

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

NICEATM ED (78): Reference chemicals used in NICEATM BG1Luc Estrogen Receptor Transactivation Assay validation study (Method Validation)
TOX21 LIST1 (8205): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)
NTP CYTOTOX (1353): Compound Cytotoxicity Profiling Using Quantitative High-Throughput Screening (International Research Projects)