Chelist Moleculee
cas:682340-46-1
einecs:
smiles:CN1CCCC1CCN1C(=CC2=CC=CC=C12)C1=C(C(=O)NC1=O)C1=CC2=C(N1)C=CC=C2
name:Bisindolylmaleimide
MW:438.5209
formula:C27H26N4O2
InChi:
InChiKey:
SMARTS:
Other names
Bisindolylmaleimide 2
Bisindolylmaleimide
1H-Pyrrole-2,5-dione, 3-(1H-indol-2-yl)-4-[1-[2-(1-methyl-2-pyrrolidinyl)ethyl]-1H-indol-2-yl]-
BIM 2

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

ESNATS (56): Compound selection for in vitro modeling of developmental neurotoxicity (EU Research Projects)