Chelist Moleculee
JRC CODE:JRC-000412
cas:521-11-9
einecs:208-302-6
smiles:[H][C@@]12CC[C@](C)(O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C
name:mestanolone
MW:304.4669
formula:C20H32O2
InChi:
InChiKey:
SMARTS:
Other names
Mestanolone
Methybol
Methylandrostanolone
Methylantalon
NSC 18219
Preroide
RU 143
Tantarone
5α-Androstan-3-one, 17β-hydroxy-17-methyl- (6CI,7CI,8CI)
17α-Methyl-17β-hydroxy-5α-androstan-3-one
17α-Methyl-5α-androstan-17β-ol-3-one
17α-Methyl-5α-dihydrotestosterone
17α-Methylandrostan-17β-ol-3-one
17α-Methylandrostan-3-on-17β-ol
17α-Methylandrostanolone
17α-Methyldihydrotestosterone
17β-Hydroxy-17-methyl-5α-androstan-3-one
17β-Hydroxy-17α-methyl-3-androstanone
17β-Hydroxy-17α-methyl-5α-androstan-3-one
5α-Androstan-17α-methyl-17β-ol-3-one
Androstalone
Assimil
Ermalone
Mestalone
Mestanolon

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

TOX21 LIST1 (8205): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)
FP6 ReProTect (133): Test chemicals used for the development of in vitro tests within the FP6 project .ReProTect (EU Research Projects)