Chelist Moleculee
cas:51-83-2
einecs:200-127-3
smiles:C[N+](C)(C)CCOC(=O)N.[Cl-]
name:carbachol
component:462-58-8
MW:182.649
formula:C6H15ClN2O2
InChi:
InChiKey:
SMARTS:
Other names
Ethanaminium, 2-[(aminocarbonyl)oxy]-N,N,N-trimethyl-, chloride (1:1)
Choline, chloride, carbamate (6CI,8CI)
Ethanaminium, 2-[(aminocarbonyl)oxy]-N,N,N-trimethyl-, chloride (9CI)
(2-Carbamoyloxyethyl)trimethylammonium chloride
(2-Hydroxyethyl)trimethyl ammonium chloride carbamate
Carbachol
Carbachol chloride
Carbacholin
Carbacholine
Carbacholine chloride
Carbacolina
Carbaminocholine chloride
Carbaminoylcholine chloride
Carbamiotin
Carbamoylcholine chloride
Carbamoylcholine-hydrochloride
Carbamylcholine chloride
Carbastat Intraocular
Carbochol
Carbocholin
Carbocholine
Carbyl
Carcholin
Choline carbamate chloride
Coletyl
Doryl
Doryl (pharmaceutical)
Isopto Carbachol
Jestryl
Lentin
Miostat
Moryl
Vasoperif
γ-Carbamoyl choline chloride

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

TOX21 LIST1 (8205): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)
SEURAT-1 GC (19): SEURAT-1 Gold Compounds (EU Research Projects)