Chelist Moleculee
JRC CODE:JRC-000045
cas:51-63-8
einecs:200-111-6
smiles:S(=O)(=O)(O)O.c1(C[C@@H](N)C)ccccc1.c1(C[C@@H](N)C)ccccc1
name:Dexamphetamine Sulphate
MW:368.491
formula:C18H28N2O4S
InChi:
InChiKey:
SMARTS:
Other names
Amsustain
Ardex
Betafedrina
Betaphedrine
D-Amphetamine sulfate
D-Ate phenyl 747
DAS
Dadex
Dex-Sule
Dexalme
Dexalone
Dexampex
Dexamphetamine sulfate
Dexamphetamine sulphate
Dexedrine
Dexedrine Sulfate
Dexten
Dextro-1-phenyl-2-amino-propane sulfate
Dextro-α-methylphenethylamine sulfate
Dextro-β-phenylisopropylamine sulfate
Dextroamphetamine sulfate
Dextrostat
Dextrosule
Diocurb
Domafate
Dura Dex
Evrodex
Hetamine
Maxiton sulfate
Medex
NSC 27104
Obesedrin
Pellcap
S-(+)-Amphetamine sulfate
Simpamina-D
Sympamin
d-1-Phenyl-2-aminopropane sulfate
d-Amfetasul
d-Amphetamine sulfate
d-Amphetamine sulphate
d-Betafedrine
d-Betaphedrine
d-α-Methylphenethylamine sulfate
d-β-Phenylisopropylamine sulfate
Benzeneethanamine, α-methyl-, (αS)-, sulfate (2:1)
Benzeneethanamine, α-methyl-, (S)-, sulfate (2:1)
Phenethylamine, α-methyl-, sulfate (2:1), (+)- (8CI)
(+)-Amitrene
(+)-Amphetamine sulfate
(+)-Amphetamine sulphate
(S)-Amphetamine sulfate
(S)-α-Methylbenzeneethanamine sulfate
Afatin
Albemap
Amdex
Amphex

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

ACuteTox (124): Reference chemicals used in the FP6 Integrated Project ACuteTox (EU Research Projects)
TOXCAST PHASE II (535): US EPA ToxCast list - phase II (International Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)