Chelist Moleculee
cas:481658-94-0
einecs:
smiles:c1c(ccc2n(c(cc12)C(N[C@@H](C(N(Cc1ccccc1)C)=O)c1ccccc1)=O)C)NC(c1ccccc1c1ccc(cc1)C(F)(F)F)=O
name:Dirlotapide
MW:674.7102
formula:C40H33F3N4O3
InChi:
InChiKey:
SMARTS:
Other names
1H-Indole-2-carboxamide, 1-methyl-N-[(1S)-2-[methyl(phenylmethyl)amino]-2-oxo-1-phenylethyl]-5-[[[4'-(trifluoromethyl)[1,1'-biphenyl]-2-yl]carbonyl]amino]-
CP 742033
Dirlotapide
Slentrol

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

SEURAT-1 GC (19): SEURAT-1 Gold Compounds (EU Research Projects)