Chelist Moleculee
JRC CODE:JRC-000212
cas:434-22-0
einecs:207-101-0
smiles:[H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])[C@@]3([H])CCC(=O)C=C3CC[C@@]21[H]
name:Nandrolone
MW:274.3978
formula:C18H26O2
InChi:
InChiKey:
SMARTS:
Other names
Estr-4-en-3-one, 17-hydroxy-, (17β)-
Estr-4-en-3-one, 17β-hydroxy- (8CI)
(+)-19-Nortestosterone
(17β)-19-Nortestosterone
17β-Hydroxy-19-nor-4-androsten-3-one
17β-Hydroxyestr-4-en-3-one
17β-Nandrolone
17β-Nortestosterone
19-Nor-17β-hydroxy-3-ketoandrost-4-ene
19-Norandrostenolone
19-Nortestosterone
4-Estren-17β-ol-3-one
4-Estren-3-one-17β-ol
Menidrabol
NSC 3351
Nandrolon
Nandrolone
Norandrostenolon
Norandrostenolone
Nortestonate
Nortestosterone
Oestrenolon
d-13β-Methyl-17β-hydroxygon-4-en-3-one
Δ �4-Estren-17β-ol-3-one
β-Nortestosterone

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

NICEATM ED (78): Reference chemicals used in NICEATM BG1Luc Estrogen Receptor Transactivation Assay validation study (Method Validation)
TOX21 LIST1 (8205): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)
REACH REG (14803): Reach Registrations (Regulatory)