Chelist Moleculee
JRC CODE:JRC-000301
cas:39765-80-5
einecs:
smiles:ClC1C(Cl)C2C(C1Cl)C3(Cl)C(Cl)=C(Cl)C2(Cl)C3(Cl)Cl
name:4,7-Methano-1h-Indene, 1,2,3,4,5,6,7,8,8-Nonachloro-2,3,3a,4,7,7a-Hexahydro-, (1α,2β,3α,3aα,4β,7β,7aα)-
MW:444.224
formula:C10H5Cl9
InChi:
InChiKey:
SMARTS:

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

DGENV EAS (585): DG ENV EDS Database (EU Research Projects)
JRC HEPATOTOX (111): Hepatotox list (JRC Projects)