Chelist Moleculee
cas:280744-09-4
einecs:
smiles:N1C(C(=C(C1=O)c1cn(c2ccccc12)C)c1c(cc(cc1)Cl)Cl)=O
name:LiCl,SB-216763
MW:371.217
formula:C19H12Cl2N2O2
InChi:
InChiKey:
SMARTS:
Other names
LiCl,SB-216763

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

ESNATS (56): Compound selection for in vitro modeling of developmental neurotoxicity (EU Research Projects)