|
cas: | 125-84-8 |
---|---|
einecs: | 204-756-4 |
smiles: | CCC1(CCC(=O)NC1=O)c2ccc(N)cc2 |
name: | Aminoglutethimide |
MW: | 232.2783 |
formula: | C13H16N2O2 |
InChi: | |
InChiKey: | |
SMARTS: |
aminoglutethimide
Aminoglutethimide
Inventory List where this chemical is present
REACH PRS (143825): ECHA list of pre-registered substances (Regulatory)FP6 ReProTect (133): Test chemicals used for the development of in vitro tests within the FP6 project .ReProTect (EU Research Projects)
TOX21 LIST1 (8198): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)
JRC METABOLISM BIOACCUMULATION (94): JRC ADME - Human bioaccumulation potential and human and rat metabolic stability and metabolite identification (JRC Projects)