Chelist Moleculee

cas:	125-84-8
einecs:	204-756-4
smiles:	CCC1(CCC(=O)NC1=O)c2ccc(N)cc2
name:	Aminoglutethimide
MW:	232.2783
formula:	C13H16N2O2
InChi:
InChiKey:
SMARTS:

Other names
aminoglutethimide
Aminoglutethimide

Search by similarity

The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = N_A&B/(N_A+N_B-N_A&B) where N_A and N_B are the number of bits set in the bit strings of molecules A and B, respectively, N_A&B is the number of bits that are set in both.

Inventory List where this chemical is present

TOX21 LIST1 (8198): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)
FP6 ReProTect (133): Test chemicals used for the development of in vitro tests within the FP6 project .ReProTect (EU Research Projects)
JRC METABOLISM BIOACCUMULATION (94): JRC ADME - Human bioaccumulation potential and human and rat metabolic stability and metabolite identification (JRC Projects)
REACH PRS (143825): ECHA list of pre-registered substances (Regulatory)