Chelist Moleculee
smiles:[S-]C(=S)NCCNC1=[S][Zn++][S-]1 |t:7,^1:8,10|

Search by similarity
Tanimoto index:
The algorithm applies nearest neighbor searching that finds molecules similar to the query object. The calculation applies the Tanimoto (or Jaccard) coefficient that is calculated by the following formula in the case of binary fingerprint (bit string) input: T(A,B) = NA&B/(NA+NB-NA&B) where NA and NB are the number of bits set in the bit strings of molecules A and B, respectively, NA&B is the number of bits that are set in both.

Inventory List where this chemical is present

NTP CYTOTOX (1353): Compound Cytotoxicity Profiling Using Quantitative High-Throughput Screening (International Research Projects)
REACH PRS (143835): ECHA list of pre-registered substances (Regulatory)
DGENV EAS (585): DG ENV EDS Database (EU Research Projects)
EDC SIN List 2.0 (22): Substitute It Now List 2.0 (NGO)