|
cas: | 117-39-5 |
---|---|
einecs: | 204-187-1 |
smiles: | OC1=C(Oc2cc(O)cc(O)c2C1=O)c3ccc(O)c(O)c3 |
name: | 3,3',4',5,7-pentahydroxyflavone |
MW: | 302.2357 |
formula: | C15H10O7 |
InChi: | |
InChiKey: | |
SMARTS: |
Quercetin
Inventory List where this chemical is present
REACH PRS (143825): ECHA list of pre-registered substances (Regulatory)ECVAMes_Positives List (723): ECVAM Ames Positives List: EURL ECVAM Genotoxicity and Carcinogenicity Database of Ames Positive Chemicals (JRC Projects)
TOX21 LIST1 (8198): Tox21 Chemical Inventory for High-Throughput Screening (International Research Projects)